C13H13NO3S — CID 84616193
4-but-3-enyl-3-oxo-1,4-benzothiazine-6-carboxylic acid (PubChem CID 84616193) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-but-3-enyl-3-oxo-1,4-benzothiazine-6-carboxylic acid.
| Compound Name | 4-but-3-enyl-3-oxo-1,4-benzothiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 84616193 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 4-but-3-enyl-3-oxo-1,4-benzothiazine-6-carboxylic acid |
| SMILES | C=CCCN1C(=O)CSc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C13H13NO3S/c1-2-3-6-14-10-7-9(13(16)17)4-5-11(10)18-8-12(14)15/h2,4-5,7H,1,3,6,8H2,(H,16,17) |
| InChIKey | YNBHCPSRORUFMA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|