C19H17FN2O2S — CID 5235416
N-[(4-fluorophenyl)methyl]-3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxamide (PubChem CID 5235416) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 5235416 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-oxo-4-prop-2-enyl-1,4-benzothiazine-6-carboxamide |
| SMILES | C=CCN1C(=O)CSc2ccc(C(=O)NCc3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C19H17FN2O2S/c1-2-9-22-16-10-14(5-8-17(16)25-12-18(22)23)19(24)21-11-13-3-6-15(20)7-4-13/h2-8,10H,1,9,11-12H2,(H,21,24) |
| InChIKey | OYIYJPNBJBPHAU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|