C10H8NO3S- — CID 4116383
4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate (PubChem CID 4116383) has the molecular formula C10H8NO3S- and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate.
| Compound Name | 4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 4116383 |
| Molecular Formula | C10H8NO3S- |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate |
| SMILES | CN1C(=O)CSc2ccc(C(=O)[O-])cc21 |
| InChI | InChI=1S/C10H9NO3S/c1-11-7-4-6(10(13)14)2-3-8(7)15-5-9(11)12/h2-4H,5H2,1H3,(H,13,14)/p-1 |
| InChIKey | JHMLWQWKVSDFLZ-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |