C16H12ClN2O4S2- — CID 162521393
2-chloro-4-[(4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl)amino]benzenesulfinate (PubChem CID 162521393) has the molecular formula C16H12ClN2O4S2- and a molecular weight of 395.87 g/mol. Its IUPAC name is 2-chloro-4-[(4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl)amino]benzenesulfinate.
| Compound Name | 2-chloro-4-[(4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl)amino]benzenesulfinate |
|---|---|
| PubChem CID | 162521393 |
| Molecular Formula | C16H12ClN2O4S2- |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 2-chloro-4-[(4-methyl-3-oxo-1,4-benzothiazine-6-carbonyl)amino]benzenesulfinate |
| SMILES | CN1C(=O)CSc2ccc(C(=O)Nc3ccc(S(=O)[O-])c(Cl)c3)cc21 |
| InChI | InChI=1S/C16H13ClN2O4S2/c1-19-12-6-9(2-4-13(12)24-8-15(19)20)16(21)18-10-3-5-14(25(22)23)11(17)7-10/h2-7H,8H2,1H3,(H,18,21)(H,22,23)/p-1 |
| InChIKey | HYKRLTFOAQILHH-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|