C18H14NO4S- — CID 3339807
2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate (PubChem CID 3339807) has the molecular formula C18H14NO4S- and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate.
| Compound Name | 2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 3339807 |
| Molecular Formula | C18H14NO4S- |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxylate |
| SMILES | COc1cccc(C=C2Sc3ccc(C(=O)[O-])cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C18H15NO4S/c1-19-14-10-12(18(21)22)6-7-15(14)24-16(17(19)20)9-11-4-3-5-13(8-11)23-2/h3-10H,1-2H3,(H,21,22)/p-1 |
| InChIKey | UTXSAQGYHTZPGU-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|