C30H32N3O3S+ — CID 3278270
N-(1-benzylpiperidin-1-ium-4-yl)-2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 3278270) has the molecular formula C30H32N3O3S+ and a molecular weight of 514.67 g/mol. Its IUPAC name is N-(1-benzylpiperidin-1-ium-4-yl)-2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 3278270 |
| Molecular Formula | C30H32N3O3S+ |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-(1-benzylpiperidin-1-ium-4-yl)-2-[(3-methoxyphenyl)methylidene]-4-methyl-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1cccc(C=C2Sc3ccc(C(=O)NC4CC[NH+](Cc5ccccc5)CC4)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C30H31N3O3S/c1-32-26-19-23(29(34)31-24-13-15-33(16-14-24)20-21-7-4-3-5-8-21)11-12-27(26)37-28(30(32)35)18-22-9-6-10-25(17-22)36-2/h3-12,17-19,24H,13-16,20H2,1-2H3,(H,31,34)/p+1 |
| InChIKey | RQSYQCPHAFCNSX-UHFFFAOYSA-O |
| XLogP | 3.78 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|