C16H11FNO3S- — CID 3339809
4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxylate (PubChem CID 3339809) has the molecular formula C16H11FNO3S- and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxylate.
| Compound Name | 4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 3339809 |
| Molecular Formula | C16H11FNO3S- |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxylate |
| SMILES | O=C([O-])c1ccc2c(c1)N(Cc1cccc(F)c1)C(=O)CS2 |
| InChI | InChI=1S/C16H12FNO3S/c17-12-3-1-2-10(6-12)8-18-13-7-11(16(20)21)4-5-14(13)22-9-15(18)19/h1-7H,8-9H2,(H,20,21)/p-1 |
| InChIKey | IHPSKCQQKBVUMS-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |