C22H19NO3S — CID 152959970
4-benzyl-6-[3-(furan-2-yl)propanoyl]-1,4-benzothiazin-3-one (PubChem CID 152959970) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-benzyl-6-[3-(furan-2-yl)propanoyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-benzyl-6-[3-(furan-2-yl)propanoyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 152959970 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-benzyl-6-[3-(furan-2-yl)propanoyl]-1,4-benzothiazin-3-one |
| SMILES | O=C(CCc1ccco1)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2 |
| InChI | InChI=1S/C22H19NO3S/c24-20(10-9-18-7-4-12-26-18)17-8-11-21-19(13-17)23(22(25)15-27-21)14-16-5-2-1-3-6-16/h1-8,11-13H,9-10,14-15H2 |
| InChIKey | UQJGJXIRMFFMQA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |