C16H14N2O2S — CID 53213308
N-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)formamide (PubChem CID 53213308) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)formamide.
| Compound Name | N-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)formamide |
|---|---|
| PubChem CID | 53213308 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)formamide |
| SMILES | O=CNc1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2 |
| InChI | InChI=1S/C16H14N2O2S/c19-11-17-13-6-7-15-14(8-13)18(16(20)10-21-15)9-12-4-2-1-3-5-12/h1-8,11H,9-10H2,(H,17,19) |
| InChIKey | ZIZHOAYOGXUIOU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|