C11H14N2OS — CID 115259339
4-ethyl-6-(methylamino)-1,4-benzothiazin-3-one (PubChem CID 115259339) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-ethyl-6-(methylamino)-1,4-benzothiazin-3-one.
| Compound Name | 4-ethyl-6-(methylamino)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115259339 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 4-ethyl-6-(methylamino)-1,4-benzothiazin-3-one |
| SMILES | CCN1C(=O)CSc2ccc(NC)cc21 |
| InChI | InChI=1S/C11H14N2OS/c1-3-13-9-6-8(12-2)4-5-10(9)15-7-11(13)14/h4-6,12H,3,7H2,1-2H3 |
| InChIKey | LVWWEPHBJJWTMV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |