C12H14N2O3S — CID 115140553
4-(2-hydroxypropanoyl)-6-(methylamino)-1,4-benzothiazin-3-one (PubChem CID 115140553) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-(2-hydroxypropanoyl)-6-(methylamino)-1,4-benzothiazin-3-one.
| Compound Name | 4-(2-hydroxypropanoyl)-6-(methylamino)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115140553 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-(2-hydroxypropanoyl)-6-(methylamino)-1,4-benzothiazin-3-one |
| SMILES | CNc1ccc2c(c1)N(C(=O)C(C)O)C(=O)CS2 |
| InChI | InChI=1S/C12H14N2O3S/c1-7(15)12(17)14-9-5-8(13-2)3-4-10(9)18-6-11(14)16/h3-5,7,13,15H,6H2,1-2H3 |
| InChIKey | CNPIPPSELQBUGS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |