About 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde
2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde (PubChem CID 115165953) has the molecular formula C10H8N2O3S
and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde.
Molecular Properties
| Compound Name | 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde |
| PubChem CID | 115165953 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde |
| SMILES | Nc1ccc2c(c1)N(C(=O)C=O)C(=O)CS2 |
| InChI | InChI=1S/C10H8N2O3S/c11-6-1-2-8-7(3-6)12(9(14)4-13)10(15)5-16-8/h1-4H,5,11H2 |
| InChIKey | JKAKVNLHAJQCNP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde?
The IUPAC name of 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde (CID 115165953) is 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde.
What is the SMILES notation for 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde?
The canonical SMILES for 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde is Nc1ccc2c(c1)N(C(=O)C=O)C(=O)CS2.
What is the InChIKey of 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde?
The InChIKey is JKAKVNLHAJQCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S/c11-6-1-2-8-7(3-6)12(9(14)4-13)10(15)5-16-8/h1-4H,5,11H2.
What are the key properties of 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde?
2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde has a molecular weight of 236.25 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-3-oxo-1,4-benzothiazin-4-yl)-2-oxoacetaldehyde is sourced from PubChem (CID 115165953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).