C10H10N2O2S2 — CID 115166954
6-amino-4-(2-sulfanylacetyl)-1,4-benzothiazin-3-one (PubChem CID 115166954) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 6-amino-4-(2-sulfanylacetyl)-1,4-benzothiazin-3-one.
| Compound Name | 6-amino-4-(2-sulfanylacetyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115166954 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 6-amino-4-(2-sulfanylacetyl)-1,4-benzothiazin-3-one |
| SMILES | Nc1ccc2c(c1)N(C(=O)CS)C(=O)CS2 |
| InChI | InChI=1S/C10H10N2O2S2/c11-6-1-2-8-7(3-6)12(9(13)4-15)10(14)5-16-8/h1-3,15H,4-5,11H2 |
| InChIKey | VWIJVVZVOWYCEI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|