C10H12N2OS2 — CID 115227964
6-(aminomethyl)-4-(sulfanylmethyl)-1,4-benzothiazin-3-one (PubChem CID 115227964) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-(aminomethyl)-4-(sulfanylmethyl)-1,4-benzothiazin-3-one.
| Compound Name | 6-(aminomethyl)-4-(sulfanylmethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115227964 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 6-(aminomethyl)-4-(sulfanylmethyl)-1,4-benzothiazin-3-one |
| SMILES | NCc1ccc2c(c1)N(CS)C(=O)CS2 |
| InChI | InChI=1S/C10H12N2OS2/c11-4-7-1-2-9-8(3-7)12(6-14)10(13)5-15-9/h1-3,14H,4-6,11H2 |
| InChIKey | QFEXSDHFIVEOGR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|