C10H10BrNOS — CID 84615722
6-bromo-4-ethyl-1,4-benzothiazin-3-one (PubChem CID 84615722) has the molecular formula C10H10BrNOS and a molecular weight of 272.17 g/mol. Its IUPAC name is 6-bromo-4-ethyl-1,4-benzothiazin-3-one.
| Compound Name | 6-bromo-4-ethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615722 |
| Molecular Formula | C10H10BrNOS |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 6-bromo-4-ethyl-1,4-benzothiazin-3-one |
| SMILES | CCN1C(=O)CSc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H10BrNOS/c1-2-12-8-5-7(11)3-4-9(8)14-6-10(12)13/h3-5H,2,6H2,1H3 |
| InChIKey | QRDANKHKYSCZLN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |