C10H11ClN2OS — CID 115263062
6-(aminomethyl)-4-(chloromethyl)-1,4-benzothiazin-3-one (PubChem CID 115263062) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 6-(aminomethyl)-4-(chloromethyl)-1,4-benzothiazin-3-one.
| Compound Name | 6-(aminomethyl)-4-(chloromethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115263062 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 6-(aminomethyl)-4-(chloromethyl)-1,4-benzothiazin-3-one |
| SMILES | NCc1ccc2c(c1)N(CCl)C(=O)CS2 |
| InChI | InChI=1S/C10H11ClN2OS/c11-6-13-8-3-7(4-12)1-2-9(8)15-5-10(13)14/h1-3H,4-6,12H2 |
| InChIKey | JISOJXPBMXGERQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|