C12H17N3OS — CID 117040210
6-amino-4-(4-aminobutan-2-yl)-1,4-benzothiazin-3-one (PubChem CID 117040210) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-amino-4-(4-aminobutan-2-yl)-1,4-benzothiazin-3-one.
| Compound Name | 6-amino-4-(4-aminobutan-2-yl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 117040210 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 6-amino-4-(4-aminobutan-2-yl)-1,4-benzothiazin-3-one |
| SMILES | CC(CCN)N1C(=O)CSc2ccc(N)cc21 |
| InChI | InChI=1S/C12H17N3OS/c1-8(4-5-13)15-10-6-9(14)2-3-11(10)17-7-12(15)16/h2-3,6,8H,4-5,7,13-14H2,1H3 |
| InChIKey | MBEDFPMYJFWTCU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|