C11H8N2O2S — CID 84616133
2-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)acetonitrile (PubChem CID 84616133) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)acetonitrile.
| Compound Name | 2-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)acetonitrile |
|---|---|
| PubChem CID | 84616133 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-(6-formyl-3-oxo-1,4-benzothiazin-4-yl)acetonitrile |
| SMILES | N#CCN1C(=O)CSc2ccc(C=O)cc21 |
| InChI | InChI=1S/C11H8N2O2S/c12-3-4-13-9-5-8(6-14)1-2-10(9)16-7-11(13)15/h1-2,5-6H,4,7H2 |
| InChIKey | HOPHKOUFHAHMMH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|