About 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine
4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 130948751) has the molecular formula C9H12N2OS2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine.
Molecular Properties
| Compound Name | 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| PubChem CID | 130948751 |
| Molecular Formula | C9H12N2OS2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | CS(=O)N1CCSc2ccc(N)cc21 |
| InChI | InChI=1S/C9H12N2OS2/c1-14(12)11-4-5-13-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5,10H2,1H3 |
| InChIKey | UGTVFULLAKDUQU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine?
The IUPAC name of 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine (CID 130948751) is 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine.
What is the SMILES notation for 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine?
The canonical SMILES for 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine is CS(=O)N1CCSc2ccc(N)cc21.
What is the InChIKey of 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine?
The InChIKey is UGTVFULLAKDUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS2/c1-14(12)11-4-5-13-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5,10H2,1H3.
What are the key properties of 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine?
4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine has a molecular weight of 228.34 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine is sourced from PubChem (CID 130948751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).