C9H12N2OS2 — CID 130948751
4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 130948751) has the molecular formula C9H12N2OS2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 130948751 |
| Molecular Formula | C9H12N2OS2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-methylsulfinyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | CS(=O)N1CCSc2ccc(N)cc21 |
| InChI | InChI=1S/C9H12N2OS2/c1-14(12)11-4-5-13-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5,10H2,1H3 |
| InChIKey | UGTVFULLAKDUQU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|