C9H13N3O2S2 — CID 114804639
6-amino-N-methyl-2,3-dihydro-1,4-benzothiazine-4-sulfonamide (PubChem CID 114804639) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 6-amino-N-methyl-2,3-dihydro-1,4-benzothiazine-4-sulfonamide.
| Compound Name | 6-amino-N-methyl-2,3-dihydro-1,4-benzothiazine-4-sulfonamide |
|---|---|
| PubChem CID | 114804639 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 6-amino-N-methyl-2,3-dihydro-1,4-benzothiazine-4-sulfonamide |
| SMILES | CNS(=O)(=O)N1CCSc2ccc(N)cc21 |
| InChI | InChI=1S/C9H13N3O2S2/c1-11-16(13,14)12-4-5-15-9-3-2-7(10)6-8(9)12/h2-3,6,11H,4-5,10H2,1H3 |
| InChIKey | USBFPWMFZRWCHK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|