About ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate
ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate (PubChem CID 61459201) has the molecular formula C13H18N2O4S2
and a molecular weight of 330.43 g/mol. Its IUPAC name is ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate |
| PubChem CID | 61459201 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)N1CCSc2ccc(N)cc21 |
| InChI | InChI=1S/C13H18N2O4S2/c1-2-19-13(16)5-8-21(17,18)15-6-7-20-12-4-3-10(14)9-11(12)15/h3-4,9H,2,5-8,14H2,1H3 |
| InChIKey | GFSMXTFYVZIRRG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate?
The IUPAC name of ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate (CID 61459201) is ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate.
What is the SMILES notation for ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate?
The canonical SMILES for ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate is CCOC(=O)CCS(=O)(=O)N1CCSc2ccc(N)cc21.
What is the InChIKey of ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate?
The InChIKey is GFSMXTFYVZIRRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4S2/c1-2-19-13(16)5-8-21(17,18)15-6-7-20-12-4-3-10(14)9-11(12)15/h3-4,9H,2,5-8,14H2,1H3.
What are the key properties of ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate?
ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate has a molecular weight of 330.43 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)sulfonyl]propanoate is sourced from PubChem (CID 61459201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).