C12H17N3O3S2 — CID 61036898
4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 61036898) has the molecular formula C12H17N3O3S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 61036898 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)N1CCOCC1)CCS2 |
| InChI | InChI=1S/C12H17N3O3S2/c13-10-1-2-12-11(9-10)15(5-8-19-12)20(16,17)14-3-6-18-7-4-14/h1-2,9H,3-8,13H2 |
| InChIKey | WEPRKEYRCICMCT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|