About 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine
4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 61036898) has the molecular formula C12H17N3O3S2
and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine.
Molecular Properties
| Compound Name | 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| PubChem CID | 61036898 |
| Molecular Formula | C12H17N3O3S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)N1CCOCC1)CCS2 |
| InChI | InChI=1S/C12H17N3O3S2/c13-10-1-2-12-11(9-10)15(5-8-19-12)20(16,17)14-3-6-18-7-4-14/h1-2,9H,3-8,13H2 |
| InChIKey | WEPRKEYRCICMCT-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine?
The IUPAC name of 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine (CID 61036898) is 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine.
What is the SMILES notation for 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine?
The canonical SMILES for 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine is Nc1ccc2c(c1)N(S(=O)(=O)N1CCOCC1)CCS2.
What is the InChIKey of 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine?
The InChIKey is WEPRKEYRCICMCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S2/c13-10-1-2-12-11(9-10)15(5-8-19-12)20(16,17)14-3-6-18-7-4-14/h1-2,9H,3-8,13H2.
What are the key properties of 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine?
4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine has a molecular weight of 315.42 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-ylsulfonyl-2,3-dihydro-1,4-benzothiazin-6-amine is sourced from PubChem (CID 61036898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).