C9H10ClNO2S2 — CID 91662295
6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 91662295) has the molecular formula C9H10ClNO2S2 and a molecular weight of 263.77 g/mol. Its IUPAC name is 6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 91662295 |
| Molecular Formula | C9H10ClNO2S2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CS(=O)(=O)N1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H10ClNO2S2/c1-15(12,13)11-4-5-14-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5H2,1H3 |
| InChIKey | NDEZDGLHPZJMAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |