C12H18N2O2S2 — CID 54905258
4-(2-ethylsulfonylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 54905258) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-(2-ethylsulfonylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-(2-ethylsulfonylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 54905258 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-(2-ethylsulfonylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | CCS(=O)(=O)CCN1CCSc2ccc(N)cc21 |
| InChI | InChI=1S/C12H18N2O2S2/c1-2-18(15,16)8-6-14-5-7-17-12-4-3-10(13)9-11(12)14/h3-4,9H,2,5-8,13H2,1H3 |
| InChIKey | SUBGTNONLSZEKW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|