C14H16N2S2 — CID 55237866
4-(2-thiophen-2-ylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 55237866) has the molecular formula C14H16N2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 4-(2-thiophen-2-ylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-(2-thiophen-2-ylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 55237866 |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(2-thiophen-2-ylethyl)-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | Nc1ccc2c(c1)N(CCc1cccs1)CCS2 |
| InChI | InChI=1S/C14H16N2S2/c15-11-3-4-14-13(10-11)16(7-9-18-14)6-5-12-2-1-8-17-12/h1-4,8,10H,5-7,9,15H2 |
| InChIKey | IDEMQFOTNMDMSB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|