C15H15BrN2S — CID 54905540
4-[(2-bromophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 54905540) has the molecular formula C15H15BrN2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-[(2-bromophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 54905540 |
| Molecular Formula | C15H15BrN2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4-[(2-bromophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | Nc1ccc2c(c1)N(Cc1ccccc1Br)CCS2 |
| InChI | InChI=1S/C15H15BrN2S/c16-13-4-2-1-3-11(13)10-18-7-8-19-15-6-5-12(17)9-14(15)18/h1-6,9H,7-8,10,17H2 |
| InChIKey | DIRJYCZUDGVBMP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|