C16H14ClN3S — CID 102668620
4-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)methyl]-3-chlorobenzonitrile (PubChem CID 102668620) has the molecular formula C16H14ClN3S and a molecular weight of 315.83 g/mol. Its IUPAC name is 4-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)methyl]-3-chlorobenzonitrile.
| Compound Name | 4-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)methyl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 102668620 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-[(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)methyl]-3-chlorobenzonitrile |
| SMILES | N#Cc1ccc(CN2CCSc3ccc(N)cc32)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClN3S/c17-14-7-11(9-18)1-2-12(14)10-20-5-6-21-16-4-3-13(19)8-15(16)20/h1-4,7-8H,5-6,10,19H2 |
| InChIKey | IRIMZPYEJULILE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|