C15H14ClFN2S — CID 103038305
4-[(3-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 103038305) has the molecular formula C15H14ClFN2S and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 103038305 |
| Molecular Formula | C15H14ClFN2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | Nc1ccc2c(c1)N(Cc1ccc(F)c(Cl)c1)CCS2 |
| InChI | InChI=1S/C15H14ClFN2S/c16-12-7-10(1-3-13(12)17)9-19-5-6-20-15-4-2-11(18)8-14(15)19/h1-4,7-8H,5-6,9,18H2 |
| InChIKey | IIHYAQCOLIADJZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|