C12H11ClFNO2 — CID 79516488
1-[(3-chloro-4-fluorophenyl)methyl]piperidine-2,4-dione (PubChem CID 79516488) has the molecular formula C12H11ClFNO2 and a molecular weight of 255.68 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]piperidine-2,4-dione.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 79516488 |
| Molecular Formula | C12H11ClFNO2 |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]piperidine-2,4-dione |
| SMILES | O=C1CCN(Cc2ccc(F)c(Cl)c2)C(=O)C1 |
| InChI | InChI=1S/C12H11ClFNO2/c13-10-5-8(1-2-11(10)14)7-15-4-3-9(16)6-12(15)17/h1-2,5H,3-4,6-7H2 |
| InChIKey | SEAFVLDOWCSJHC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|