C13H13ClFNO3 — CID 103038424
1-[(3-chloro-4-fluorophenyl)methyl]-6-oxopiperidine-3-carboxylic acid (PubChem CID 103038424) has the molecular formula C13H13ClFNO3 and a molecular weight of 285.70 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-6-oxopiperidine-3-carboxylic acid.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 103038424 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-6-oxopiperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCC(=O)N(Cc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H13ClFNO3/c14-10-5-8(1-3-11(10)15)6-16-7-9(13(18)19)2-4-12(16)17/h1,3,5,9H,2,4,6-7H2,(H,18,19) |
| InChIKey | MRYIURFGZWSKDZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |