C16H17FN2OS — CID 104792433
4-[(2-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 104792433) has the molecular formula C16H17FN2OS and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-[(2-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 104792433 |
| Molecular Formula | C16H17FN2OS |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[(2-fluoro-3-methoxyphenyl)methyl]-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | COc1cccc(CN2CCSc3ccc(N)cc32)c1F |
| InChI | InChI=1S/C16H17FN2OS/c1-20-14-4-2-3-11(16(14)17)10-19-7-8-21-15-6-5-12(18)9-13(15)19/h2-6,9H,7-8,10,18H2,1H3 |
| InChIKey | UJLQFPWFNIELEB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|