C16H26N2S — CID 63533513
4-octyl-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 63533513) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is 4-octyl-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-octyl-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 63533513 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-octyl-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | CCCCCCCCN1CCSc2ccc(N)cc21 |
| InChI | InChI=1S/C16H26N2S/c1-2-3-4-5-6-7-10-18-11-12-19-16-9-8-14(17)13-15(16)18/h8-9,13H,2-7,10-12,17H2,1H3 |
| InChIKey | JBGUOUNFAQMSOZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|