C14H18N2OS — CID 84615614
7-amino-4-cyclohexyl-1,4-benzothiazin-3-one (PubChem CID 84615614) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 7-amino-4-cyclohexyl-1,4-benzothiazin-3-one.
| Compound Name | 7-amino-4-cyclohexyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615614 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 7-amino-4-cyclohexyl-1,4-benzothiazin-3-one |
| SMILES | Nc1ccc2c(c1)SCC(=O)N2C1CCCCC1 |
| InChI | InChI=1S/C14H18N2OS/c15-10-6-7-12-13(8-10)18-9-14(17)16(12)11-4-2-1-3-5-11/h6-8,11H,1-5,9,15H2 |
| InChIKey | YCGJDXQXFOTFOC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|