C24H20N4O2S — CID 156871891
1-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)-3-(1H-indol-3-yl)urea (PubChem CID 156871891) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)-3-(1H-indol-3-yl)urea.
| Compound Name | 1-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)-3-(1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 156871891 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-(4-benzyl-3-oxo-1,4-benzothiazin-6-yl)-3-(1H-indol-3-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2)Nc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H20N4O2S/c29-23-15-31-22-11-10-17(12-21(22)28(23)14-16-6-2-1-3-7-16)26-24(30)27-20-13-25-19-9-5-4-8-18(19)20/h1-13,25H,14-15H2,(H2,26,27,30) |
| InChIKey | AVKUNSIBJUSQEK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |