C25H21N5OS — CID 167463830
1-[4-[(2-cyanophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-7-yl]-3-(1H-indol-3-yl)urea (PubChem CID 167463830) has the molecular formula C25H21N5OS and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-[4-[(2-cyanophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-7-yl]-3-(1H-indol-3-yl)urea.
| Compound Name | 1-[4-[(2-cyanophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-7-yl]-3-(1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 167463830 |
| Molecular Formula | C25H21N5OS |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[4-[(2-cyanophenyl)methyl]-2,3-dihydro-1,4-benzothiazin-7-yl]-3-(1H-indol-3-yl)urea |
| SMILES | N#Cc1ccccc1CN1CCSc2cc(NC(=O)Nc3c[nH]c4ccccc34)ccc21 |
| InChI | InChI=1S/C25H21N5OS/c26-14-17-5-1-2-6-18(17)16-30-11-12-32-24-13-19(9-10-23(24)30)28-25(31)29-22-15-27-21-8-4-3-7-20(21)22/h1-10,13,15,27H,11-12,16H2,(H2,28,29,31) |
| InChIKey | MKQRNEVRTVRFSG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|