C26H25N5O2 — CID 175586403
1-(1-benzyl-3,4-dimethyl-2-oxo-4H-quinazolin-7-yl)-3-(1H-indol-3-yl)urea (PubChem CID 175586403) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-(1-benzyl-3,4-dimethyl-2-oxo-4H-quinazolin-7-yl)-3-(1H-indol-3-yl)urea.
| Compound Name | 1-(1-benzyl-3,4-dimethyl-2-oxo-4H-quinazolin-7-yl)-3-(1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 175586403 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-(1-benzyl-3,4-dimethyl-2-oxo-4H-quinazolin-7-yl)-3-(1H-indol-3-yl)urea |
| SMILES | CC1c2ccc(NC(=O)Nc3c[nH]c4ccccc34)cc2N(Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C26H25N5O2/c1-17-20-13-12-19(28-25(32)29-23-15-27-22-11-7-6-10-21(22)23)14-24(20)31(26(33)30(17)2)16-18-8-4-3-5-9-18/h3-15,17,27H,16H2,1-2H3,(H2,28,29,32) |
| InChIKey | LZGLMGIJCANNBP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |