C10H9ClN4O3S — CID 106551164
6-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 106551164) has the molecular formula C10H9ClN4O3S and a molecular weight of 300.73 g/mol. Its IUPAC name is 6-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 6-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106551164 |
| Molecular Formula | C10H9ClN4O3S |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 6-chloro-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCN1C(=O)CSC1=O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C10H9ClN4O3S/c11-7-4-12-3-6(14-7)9(17)13-1-2-15-8(16)5-19-10(15)18/h3-4H,1-2,5H2,(H,13,17) |
| InChIKey | OJKUXIFRJDILOU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|