C13H14ClN3O4S — CID 108885364
1-[(4-chlorophenoxy)methyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea (PubChem CID 108885364) has the molecular formula C13H14ClN3O4S and a molecular weight of 343.79 g/mol. Its IUPAC name is 1-[(4-chlorophenoxy)methyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea.
| Compound Name | 1-[(4-chlorophenoxy)methyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 108885364 |
| Molecular Formula | C13H14ClN3O4S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 1-[(4-chlorophenoxy)methyl]-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]urea |
| SMILES | O=C(NCCN1C(=O)CSC1=O)NCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClN3O4S/c14-9-1-3-10(4-2-9)21-8-16-12(19)15-5-6-17-11(18)7-22-13(17)20/h1-4H,5-8H2,(H2,15,16,19) |
| InChIKey | HKZVCGGKCSUFRM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|