C29H25FN2O3 — CID 60591826
3-[(2-fluorobenzoyl)amino]-4-methyl-N-[2-(2-phenylphenoxy)ethyl]benzamide (PubChem CID 60591826) has the molecular formula C29H25FN2O3 and a molecular weight of 468.53 g/mol. Its IUPAC name is 3-[(2-fluorobenzoyl)amino]-4-methyl-N-[2-(2-phenylphenoxy)ethyl]benzamide.
| Compound Name | 3-[(2-fluorobenzoyl)amino]-4-methyl-N-[2-(2-phenylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 60591826 |
| Molecular Formula | C29H25FN2O3 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-[(2-fluorobenzoyl)amino]-4-methyl-N-[2-(2-phenylphenoxy)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCOc2ccccc2-c2ccccc2)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C29H25FN2O3/c1-20-15-16-22(19-26(20)32-29(34)24-12-5-7-13-25(24)30)28(33)31-17-18-35-27-14-8-6-11-23(27)21-9-3-2-4-10-21/h2-16,19H,17-18H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | HGHUUIPOMRLJOJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|