C24H24FN3O4S — CID 55687228
N-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide (PubChem CID 55687228) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide.
| Compound Name | N-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 55687228 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2-fluorobenzoyl)amino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccccc2S(=O)(=O)N(C)C)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C24H24FN3O4S/c1-16-12-13-17(14-21(16)27-24(30)19-9-5-6-10-20(19)25)23(29)26-15-18-8-4-7-11-22(18)33(31,32)28(2)3/h4-14H,15H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | CGRVIOCZBSTCJB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |