C18H23N3O5S2 — CID 24614043
N-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-5-(methylsulfamoyl)benzamide (PubChem CID 24614043) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-5-(methylsulfamoyl)benzamide.
| Compound Name | N-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24614043 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[[2-(dimethylsulfamoyl)phenyl]methyl]-2-methyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(C(=O)NCc2ccccc2S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H23N3O5S2/c1-13-9-10-15(27(23,24)19-2)11-16(13)18(22)20-12-14-7-5-6-8-17(14)28(25,26)21(3)4/h5-11,19H,12H2,1-4H3,(H,20,22) |
| InChIKey | ROUIGHCVCRIABC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |