C23H30N4O4 — CID 3446591
1-(2-methoxyphenyl)-3-[3-[(2-methoxyphenyl)carbamoylamino]-4-methylcyclohexyl]urea (PubChem CID 3446591) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[3-[(2-methoxyphenyl)carbamoylamino]-4-methylcyclohexyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[3-[(2-methoxyphenyl)carbamoylamino]-4-methylcyclohexyl]urea |
|---|---|
| PubChem CID | 3446591 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[3-[(2-methoxyphenyl)carbamoylamino]-4-methylcyclohexyl]urea |
| SMILES | COc1ccccc1NC(=O)NC1CCC(C)C(NC(=O)Nc2ccccc2OC)C1 |
| InChI | InChI=1S/C23H30N4O4/c1-15-12-13-16(24-22(28)25-17-8-4-6-10-20(17)30-2)14-19(15)27-23(29)26-18-9-5-7-11-21(18)31-3/h4-11,15-16,19H,12-14H2,1-3H3,(H2,24,25,28)(H2,26,27,29) |
| InChIKey | LBSQHZISZRXLOR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |