C17H17Cl2N3O4S — CID 56511069
N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56511069) has the molecular formula C17H17Cl2N3O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56511069 |
| Molecular Formula | C17H17Cl2N3O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methyl-2-(4-sulfamoylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O4S/c1-22(10-16(23)21-12-4-7-14(18)15(19)9-12)17(24)8-11-2-5-13(6-3-11)27(20,25)26/h2-7,9H,8,10H2,1H3,(H,21,23)(H2,20,25,26) |
| InChIKey | YNIVNVMFIAOIPH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |