C10H11NO2S3 — CID 88813486
(4-prop-2-enylsulfonylphenyl)carbamodithioic acid (PubChem CID 88813486) has the molecular formula C10H11NO2S3 and a molecular weight of 273.40 g/mol. Its IUPAC name is (4-prop-2-enylsulfonylphenyl)carbamodithioic acid.
| Compound Name | (4-prop-2-enylsulfonylphenyl)carbamodithioic acid |
|---|---|
| PubChem CID | 88813486 |
| Molecular Formula | C10H11NO2S3 |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (4-prop-2-enylsulfonylphenyl)carbamodithioic acid |
| SMILES | C=CCS(=O)(=O)c1ccc(NC(=S)S)cc1 |
| InChI | InChI=1S/C10H11NO2S3/c1-2-7-16(12,13)9-5-3-8(4-6-9)11-10(14)15/h2-6H,1,7H2,(H2,11,14,15) |
| InChIKey | GBBVZEVOKCSKLU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|