C16H12Cl2N4O3 — CID 19661193
N-(4-carbamoylphenyl)-N'-[(E)-(2,3-dichlorophenyl)methylideneamino]oxamide (PubChem CID 19661193) has the molecular formula C16H12Cl2N4O3 and a molecular weight of 379.20 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-N'-[(E)-(2,3-dichlorophenyl)methylideneamino]oxamide.
| Compound Name | N-(4-carbamoylphenyl)-N'-[(E)-(2,3-dichlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 19661193 |
| Molecular Formula | C16H12Cl2N4O3 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-(4-carbamoylphenyl)-N'-[(E)-(2,3-dichlorophenyl)methylideneamino]oxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)N/N=C/c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2N4O3/c17-12-3-1-2-10(13(12)18)8-20-22-16(25)15(24)21-11-6-4-9(5-7-11)14(19)23/h1-8H,(H2,19,23)(H,21,24)(H,22,25)/b20-8+ |
| InChIKey | TYSXBHAGOJBTKE-DNTJNYDQSA-N |
| XLogP | 2.18 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|