C15H11Cl2N3O2 — CID 6871246
N-(2-chlorophenyl)-N'-[(E)-(3-chlorophenyl)methylideneamino]oxamide (PubChem CID 6871246) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(E)-(3-chlorophenyl)methylideneamino]oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(E)-(3-chlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6871246 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(E)-(3-chlorophenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O2/c16-11-5-3-4-10(8-11)9-18-20-15(22)14(21)19-13-7-2-1-6-12(13)17/h1-9H,(H,19,21)(H,20,22)/b18-9+ |
| InChIKey | FIINAEMLIMYSIW-GIJQJNRQSA-N |
| XLogP | 3.08 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|