C30H29N3O4 — CID 4109953
N-(2,4-dimethylphenyl)-N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide (PubChem CID 4109953) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,4-dimethylphenyl)-N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 4109953 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccc(C)cc2C)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H29N3O4/c1-4-36-28-17-22(18-31-33-30(35)29(34)32-26-14-12-20(2)16-21(26)3)13-15-27(28)37-19-24-10-7-9-23-8-5-6-11-25(23)24/h5-18H,4,19H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | WUQACUNXDXKIHJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|