C24H23ClN2O6 — CID 3582011
N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-trihydroxybenzamide (PubChem CID 3582011) has the molecular formula C24H23ClN2O6 and a molecular weight of 470.91 g/mol. Its IUPAC name is N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 3582011 |
| Molecular Formula | C24H23ClN2O6 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-trihydroxybenzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cc(O)c(O)c(O)c2)cc1COc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C24H23ClN2O6/c1-13-6-18(7-14(2)22(13)25)33-12-17-8-15(4-5-21(17)32-3)11-26-27-24(31)16-9-19(28)23(30)20(29)10-16/h4-11,28-30H,12H2,1-3H3,(H,27,31) |
| InChIKey | QFTAWFSISYAPJK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|