C28H31ClN2O6 — CID 6088368
N-[(Z)-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-triethoxybenzamide (PubChem CID 6088368) has the molecular formula C28H31ClN2O6 and a molecular weight of 527.02 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(Z)-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 6088368 |
| Molecular Formula | C28H31ClN2O6 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[(Z)-[3-[(4-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C\c2ccc(OC)c(COc3ccc(Cl)cc3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C28H31ClN2O6/c1-5-34-25-15-20(16-26(35-6-2)27(25)36-7-3)28(32)31-30-17-19-8-13-24(33-4)21(14-19)18-37-23-11-9-22(29)10-12-23/h8-17H,5-7,18H2,1-4H3,(H,31,32)/b30-17- |
| InChIKey | SHWGEQWTBUAENJ-LQNQUEJISA-N |
| XLogP | 5.89 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|