C19H18ClN5OS — CID 135730941
2-anilino-N-[(E)-[4-chloro-2-(4-methylanilino)-1,3-thiazol-5-yl]methylideneamino]acetamide (PubChem CID 135730941) has the molecular formula C19H18ClN5OS and a molecular weight of 399.91 g/mol. Its IUPAC name is 2-anilino-N-[(E)-[4-chloro-2-(4-methylanilino)-1,3-thiazol-5-yl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(E)-[4-chloro-2-(4-methylanilino)-1,3-thiazol-5-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 135730941 |
| Molecular Formula | C19H18ClN5OS |
| Molecular Weight | 399.91 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-anilino-N-[(E)-[4-chloro-2-(4-methylanilino)-1,3-thiazol-5-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(Nc2nc(Cl)c(/C=N/NC(=O)CNc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C19H18ClN5OS/c1-13-7-9-15(10-8-13)23-19-24-18(20)16(27-19)11-22-25-17(26)12-21-14-5-3-2-4-6-14/h2-11,21H,12H2,1H3,(H,23,24)(H,25,26)/b22-11+ |
| InChIKey | UEXWHQHKGPGQBF-SSDVNMTOSA-N |
| XLogP | 4.41 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|